astrgir1 astrgir1
  • 02-06-2021
  • Mathematics
contestada

PLEASE HELP



what's x
cos(x+pi)-sin(x-pi)=0

please show work​

Respuesta :

Аноним Аноним
  • 02-06-2021

sin(x+pi)=-sin(x)=sin(-x)=cos(pi/2)

cos (x+pi)=-cos(x)

So according to the question:

cos(pi/2 +x)=cos(x)

Using the solution of cos, obtain:

(pi/2) + x = 2pi +- (x)

case#1: (pi/2) + x = 2pi + (x)

But here, the value of x is canceled, just

case#2: (pi/2) + x = 2pi - (x)

answer------------>>>>>>>>> x=pi-pi/4

Answer Link

Otras preguntas

A _______ is formed when tectonic plates collide.
Emily had 75 buttons. She gave 15 buttons to jake. What percentage of the buttons did Emily give to hair?
PLEASE HEEELPP MEEEEEEEEE
Who is the antagonist in the book if I stay?
The Antifederalists opposed the ratification of the Constitution because the New Constitution A. divided the nation into North and South. B. didn't expand fede
Animals without backbones are called ________________. a. arthropods c. invertebrates b. chordates d. vertebrates
What is vice presidential role in running on a ticket?
What is 1/3 as a decimal?
7x+6y=21 X+3y=-12 what is the answer
The Hamilton Brush Company issued 2,500 shares of common stock worth $100,000.00 total. What is the par value of each share? A. $40.00 B. $250.00 C. $400.00 D.