idkmyusername59 idkmyusername59
  • 02-02-2021
  • Arts
contestada

What are some important things about hip hop.

Respuesta :

haleya334 haleya334
  • 02-02-2021
Some important things about hip hop is that you need to have rhythm, and style. Personally I do hip hop, and if you are being stiff, you look weird. But, if you get out of i your comfort zone and feel the music, you look good.
Answer Link

Otras preguntas

Why did Sparta become allies with Persia?
Which of the following does NOT correctly describe the kinetic molecular theory? Collisions between gas particles are inelastic. Gas particles are small and
what is 127/100 as a percent
who is willam and mary
Describe what happens when a muscle contracts
Is a hairy frog homologous or vestigial?
Why is double think so important to the Party’s survival?
HELP ASAP PLEASE - Which best describes how the arrangement of the sun, moon, and the earth affect the range of the tides during a spring tide?A. Because the ea
What is the value of x? A 3 B 5 C 45 D 90
cos(x/3)cos(x/3)=1/2(1+cos(2x/3))